C22H30F2N4O3 — CID 111797207
1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111797207) has the molecular formula C22H30F2N4O3 and a molecular weight of 436.50 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111797207 |
| Molecular Formula | C22H30F2N4O3 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCC(c1c(F)cccc1F)N(C)C |
| InChI | InChI=1S/C22H30F2N4O3/c1-25-22(26-12-14-10-18(29-4)21(31-6)19(11-14)30-5)27-13-17(28(2)3)20-15(23)8-7-9-16(20)24/h7-11,17H,12-13H2,1-6H3,(H2,25,26,27) |
| InChIKey | JUDWPFKKIGXEQU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|