C20H31IN4O4 — CID 111376145
1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111376145) has the molecular formula C20H31IN4O4 and a molecular weight of 518.40 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111376145 |
| Molecular Formula | C20H31IN4O4 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCC(c1ccco1)N(C)C.I |
| InChI | InChI=1S/C20H30N4O4.HI/c1-21-20(23-13-15(24(2)3)16-8-7-9-28-16)22-12-14-10-17(25-4)19(27-6)18(11-14)26-5;/h7-11,15H,12-13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | VIWYDRPDQORZRF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|