C21H33IN4O3 — CID 111241858
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111241858) has the molecular formula C21H33IN4O3 and a molecular weight of 516.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111241858 |
| Molecular Formula | C21H33IN4O3 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccco1)N(C)C)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C21H32N4O3.HI/c1-22-21(23-15-17(24(2)3)18-8-7-13-28-18)25(4)12-11-16-9-10-19(26-5)20(14-16)27-6;/h7-10,13-14,17H,11-12,15H2,1-6H3,(H,22,23);1H |
| InChIKey | VVRCQKCMOSLUQO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|