C19H27F2IN4O2 — CID 111288600
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111288600) has the molecular formula C19H27F2IN4O2 and a molecular weight of 508.35 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288600 |
| Molecular Formula | C19H27F2IN4O2 |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccco1)N(C)C)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C19H26F2N4O2.HI/c1-22-19(23-12-16(24(2)3)17-6-5-11-26-17)25(4)13-14-7-9-15(10-8-14)27-18(20)21;/h5-11,16,18H,12-13H2,1-4H3,(H,22,23);1H |
| InChIKey | RMJDBYPKRLFJTG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|