C18H26BrIN4O — CID 111276276
1-[(2-bromophenyl)methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111276276) has the molecular formula C18H26BrIN4O and a molecular weight of 521.24 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111276276 |
| Molecular Formula | C18H26BrIN4O |
| Molecular Weight | 521.24 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccco1)N(C)C)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C18H25BrN4O.HI/c1-20-18(23(4)13-14-8-5-6-9-15(14)19)21-12-16(22(2)3)17-10-7-11-24-17;/h5-11,16H,12-13H2,1-4H3,(H,20,21);1H |
| InChIKey | XIEAAKYPVFDLSO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|