C21H26F2IN3O3 — CID 111288688
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111288688) has the molecular formula C21H26F2IN3O3 and a molecular weight of 533.36 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288688 |
| Molecular Formula | C21H26F2IN3O3 |
| Molecular Weight | 533.36 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCCO2)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H25F2N3O3.HI/c1-24-21(26(2)14-16-3-6-17(7-4-16)29-20(22)23)25-10-9-15-5-8-18-19(13-15)28-12-11-27-18;/h3-8,13,20H,9-12,14H2,1-2H3,(H,24,25);1H |
| InChIKey | ITLMQSPVZICSRW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|