C21H25F3IN3O3 — CID 111288128
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111288128) has the molecular formula C21H25F3IN3O3 and a molecular weight of 551.35 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288128 |
| Molecular Formula | C21H25F3IN3O3 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H24F3N3O3.HI/c1-25-21(27(2)11-14-3-5-18(6-4-14)30-20(23)24)26-8-7-15-9-17(22)10-16-12-28-13-29-19(15)16;/h3-6,9-10,20H,7-8,11-13H2,1-2H3,(H,25,26);1H |
| InChIKey | IGFWRXHNKBMZNU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|