C20H23F2N3O2 — CID 111307120
3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111307120) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111307120 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-23-20(25(2)11-14-3-5-17(21)6-4-14)24-8-7-15-9-18(22)10-16-12-26-13-27-19(15)16/h3-6,9-10H,7-8,11-13H2,1-2H3,(H,23,24) |
| InChIKey | KKODQAFAJBNODB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|