C21H27FIN3O2 — CID 110951793
1-benzyl-3-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110951793) has the molecular formula C21H27FIN3O2 and a molecular weight of 499.37 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110951793 |
| Molecular Formula | C21H27FIN3O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 1-benzyl-3-ethyl-2-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(F)cc2c1OCOC2)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C21H26FN3O2.HI/c1-3-23-21(25(2)13-16-7-5-4-6-8-16)24-10-9-17-11-19(22)12-18-14-26-15-27-20(17)18;/h4-8,11-12H,3,9-10,13-15H2,1-2H3,(H,23,24);1H |
| InChIKey | GOZKIDDPNXLWGH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|