C21H28F2N4O3 — CID 111792523
1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 111792523) has the molecular formula C21H28F2N4O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111792523 |
| Molecular Formula | C21H28F2N4O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | C/N=C(\NCC(c1c(F)cccc1F)N(C)C)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H28F2N4O3/c1-24-21(26-13-10-17(28-4)20(30-6)18(11-13)29-5)25-12-16(27(2)3)19-14(22)8-7-9-15(19)23/h7-11,16H,12H2,1-6H3,(H2,24,25,26) |
| InChIKey | QHQMIXTXGFYYTB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|