C18H21BrFN3O3 — CID 111146238
1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 111146238) has the molecular formula C18H21BrFN3O3 and a molecular weight of 426.29 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111146238 |
| Molecular Formula | C18H21BrFN3O3 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | C/N=C(\NCc1ccc(Br)c(F)c1)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H21BrFN3O3/c1-21-18(22-10-11-5-6-13(19)14(20)7-11)23-12-8-15(24-2)17(26-4)16(9-12)25-3/h5-9H,10H2,1-4H3,(H2,21,22,23) |
| InChIKey | XYGGEDRWXVKCHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|