C19H18F6N2O3S — CID 42625366
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 42625366) has the molecular formula C19H18F6N2O3S and a molecular weight of 468.42 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 42625366 |
| Molecular Formula | C19H18F6N2O3S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CNC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18F6N2O3S/c1-28-14-4-10(5-15(29-2)16(14)30-3)9-26-17(31)27-13-7-11(18(20,21)22)6-12(8-13)19(23,24)25/h4-8H,9H2,1-3H3,(H2,26,27,31) |
| InChIKey | MKKSXBGNJCUXJM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|