C19H21F2N3OS — CID 100749554
1-(2,6-difluorophenyl)-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]thiourea (PubChem CID 100749554) has the molecular formula C19H21F2N3OS and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100749554 |
| Molecular Formula | C19H21F2N3OS |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]thiourea |
| SMILES | Fc1cccc(F)c1NC(=S)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C19H21F2N3OS/c20-16-6-3-7-17(21)18(16)23-19(26)22-12-14-4-1-2-5-15(14)13-24-8-10-25-11-9-24/h1-7H,8-13H2,(H2,22,23,26) |
| InChIKey | PIRSIINYSYRJMY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|