C23H29N3O3S — CID 100749611
ethyl 3-methyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methylcarbamothioylamino]benzoate (PubChem CID 100749611) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is ethyl 3-methyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-methyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100749611 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 3-methyl-4-[[2-(morpholin-4-ylmethyl)phenyl]methylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCc2ccccc2CN2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C23H29N3O3S/c1-3-29-22(27)18-8-9-21(17(2)14-18)25-23(30)24-15-19-6-4-5-7-20(19)16-26-10-12-28-13-11-26/h4-9,14H,3,10-13,15-16H2,1-2H3,(H2,24,25,30) |
| InChIKey | UKJNDEXCXVUAIT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|