C20H24FN3S — CID 8562911
1-[(4-fluorophenyl)methyl]-3-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiourea (PubChem CID 8562911) has the molecular formula C20H24FN3S and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 8562911 |
| Molecular Formula | C20H24FN3S |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)NCc2ccccc2CN2CCCC2)cc1 |
| InChI | InChI=1S/C20H24FN3S/c21-19-9-7-16(8-10-19)13-22-20(25)23-14-17-5-1-2-6-18(17)15-24-11-3-4-12-24/h1-2,5-10H,3-4,11-15H2,(H2,22,23,25) |
| InChIKey | HJGBTTMDPJHOCN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|