C21H27FN3S+ — CID 8500314
1-[(4-fluorophenyl)methyl]-3-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea (PubChem CID 8500314) has the molecular formula C21H27FN3S+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 8500314 |
| Molecular Formula | C21H27FN3S+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)NCc2ccccc2C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C21H26FN3S/c22-20-10-8-17(9-11-20)14-23-21(26)24-15-18-6-2-3-7-19(18)16-25-12-4-1-5-13-25/h2-3,6-11H,1,4-5,12-16H2,(H2,23,24,26)/p+1 |
| InChIKey | CYXYSGYHKXJOKN-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|