C14H21FN+ — CID 7446378
1-[(2-fluorophenyl)methyl]azocan-1-ium (PubChem CID 7446378) has the molecular formula C14H21FN+ and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]azocan-1-ium.
| Compound Name | 1-[(2-fluorophenyl)methyl]azocan-1-ium |
|---|---|
| PubChem CID | 7446378 |
| Molecular Formula | C14H21FN+ |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]azocan-1-ium |
| SMILES | Fc1ccccc1C[NH+]1CCCCCCC1 |
| InChI | InChI=1S/C14H20FN/c15-14-9-5-4-8-13(14)12-16-10-6-2-1-3-7-11-16/h4-5,8-9H,1-3,6-7,10-12H2/p+1 |
| InChIKey | RGYNTNDQIXAVSJ-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |