C11H14F2N+ — CID 2247087
1-[(2,6-difluorophenyl)methyl]pyrrolidin-1-ium (PubChem CID 2247087) has the molecular formula C11H14F2N+ and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]pyrrolidin-1-ium.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 2247087 |
| Molecular Formula | C11H14F2N+ |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]pyrrolidin-1-ium |
| SMILES | Fc1cccc(F)c1C[NH+]1CCCC1 |
| InChI | InChI=1S/C11H13F2N/c12-10-4-3-5-11(13)9(10)8-14-6-1-2-7-14/h3-5H,1-2,6-8H2/p+1 |
| InChIKey | IOKIJFFBMNOMDC-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |