C24H26F4O2 — CID 69233042
1,2-bis[1-[(2,6-difluorophenyl)methyl]cyclobutyl]ethane-1,2-diol (PubChem CID 69233042) has the molecular formula C24H26F4O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1,2-bis[1-[(2,6-difluorophenyl)methyl]cyclobutyl]ethane-1,2-diol.
| Compound Name | 1,2-bis[1-[(2,6-difluorophenyl)methyl]cyclobutyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 69233042 |
| Molecular Formula | C24H26F4O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1,2-bis[1-[(2,6-difluorophenyl)methyl]cyclobutyl]ethane-1,2-diol |
| SMILES | OC(C(O)C1(Cc2c(F)cccc2F)CCC1)C1(Cc2c(F)cccc2F)CCC1 |
| InChI | InChI=1S/C24H26F4O2/c25-17-5-1-6-18(26)15(17)13-23(9-3-10-23)21(29)22(30)24(11-4-12-24)14-16-19(27)7-2-8-20(16)28/h1-2,5-8,21-22,29-30H,3-4,9-14H2 |
| InChIKey | USMMMLDMRCOOBX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |