C12H16FNO — CID 116944249
[1-[amino-(2-fluorophenyl)methyl]cyclobutyl]methanol (PubChem CID 116944249) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is [1-[amino-(2-fluorophenyl)methyl]cyclobutyl]methanol.
| Compound Name | [1-[amino-(2-fluorophenyl)methyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 116944249 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | [1-[amino-(2-fluorophenyl)methyl]cyclobutyl]methanol |
| SMILES | NC(c1ccccc1F)C1(CO)CCC1 |
| InChI | InChI=1S/C12H16FNO/c13-10-5-2-1-4-9(10)11(14)12(8-15)6-3-7-12/h1-2,4-5,11,15H,3,6-8,14H2 |
| InChIKey | ORNBRHXRKBKGJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |