C18H19F2N — CID 63988826
(2,3-difluorophenyl)-(1-phenylcyclopentyl)methanamine (PubChem CID 63988826) has the molecular formula C18H19F2N and a molecular weight of 287.35 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1-phenylcyclopentyl)methanamine.
| Compound Name | (2,3-difluorophenyl)-(1-phenylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 63988826 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2,3-difluorophenyl)-(1-phenylcyclopentyl)methanamine |
| SMILES | NC(c1cccc(F)c1F)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H19F2N/c19-15-10-6-9-14(16(15)20)17(21)18(11-4-5-12-18)13-7-2-1-3-8-13/h1-3,6-10,17H,4-5,11-12,21H2 |
| InChIKey | PGFYFZCLCBXGJI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |