C18H19BrFN — CID 79721756
(5-bromo-2-fluorophenyl)-(1-phenylcyclopentyl)methanamine (PubChem CID 79721756) has the molecular formula C18H19BrFN and a molecular weight of 348.26 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-(1-phenylcyclopentyl)methanamine.
| Compound Name | (5-bromo-2-fluorophenyl)-(1-phenylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 79721756 |
| Molecular Formula | C18H19BrFN |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-(1-phenylcyclopentyl)methanamine |
| SMILES | NC(c1cc(Br)ccc1F)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H19BrFN/c19-14-8-9-16(20)15(12-14)17(21)18(10-4-5-11-18)13-6-2-1-3-7-13/h1-3,6-9,12,17H,4-5,10-11,21H2 |
| InChIKey | BVECOAUMSJUGSB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |