C17H16F3N — CID 63080571
(1-phenylcyclobutyl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 63080571) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is (1-phenylcyclobutyl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (1-phenylcyclobutyl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 63080571 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (1-phenylcyclobutyl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)c(F)c1F)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C17H16F3N/c18-13-8-7-12(14(19)15(13)20)16(21)17(9-4-10-17)11-5-2-1-3-6-11/h1-3,5-8,16H,4,9-10,21H2 |
| InChIKey | UQVURMHYUALVKV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|