C19H13F3 — CID 171476806
1-benzhydryl-2,3,4-trifluorobenzene (PubChem CID 171476806) has the molecular formula C19H13F3 and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-benzhydryl-2,3,4-trifluorobenzene.
| Compound Name | 1-benzhydryl-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 171476806 |
| Molecular Formula | C19H13F3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-benzhydryl-2,3,4-trifluorobenzene |
| SMILES | Fc1ccc(C(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C19H13F3/c20-16-12-11-15(18(21)19(16)22)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,17H |
| InChIKey | FSGVZAPIFIMCHU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|