C13H15BrFNO2 — CID 116944321
methyl 1-[amino-(5-bromo-2-fluorophenyl)methyl]cyclobutane-1-carboxylate (PubChem CID 116944321) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is methyl 1-[amino-(5-bromo-2-fluorophenyl)methyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[amino-(5-bromo-2-fluorophenyl)methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 116944321 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 1-[amino-(5-bromo-2-fluorophenyl)methyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(C(N)c2cc(Br)ccc2F)CCC1 |
| InChI | InChI=1S/C13H15BrFNO2/c1-18-12(17)13(5-2-6-13)11(16)9-7-8(14)3-4-10(9)15/h3-4,7,11H,2,5-6,16H2,1H3 |
| InChIKey | ZDIUSKASMCXWKR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |