C14H19BrFNO — CID 116761622
(5-bromo-2-fluorophenyl)-(1-ethoxycyclopentyl)methanamine (PubChem CID 116761622) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-(1-ethoxycyclopentyl)methanamine.
| Compound Name | (5-bromo-2-fluorophenyl)-(1-ethoxycyclopentyl)methanamine |
|---|---|
| PubChem CID | 116761622 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-(1-ethoxycyclopentyl)methanamine |
| SMILES | CCOC1(C(N)c2cc(Br)ccc2F)CCCC1 |
| InChI | InChI=1S/C14H19BrFNO/c1-2-18-14(7-3-4-8-14)13(17)11-9-10(15)5-6-12(11)16/h5-6,9,13H,2-4,7-8,17H2,1H3 |
| InChIKey | NRIJWCINLWDWEX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |