C16H23BrFNO2 — CID 116765825
N-[(5-bromo-2-fluorophenyl)-(4-ethoxyoxan-4-yl)methyl]ethanamine (PubChem CID 116765825) has the molecular formula C16H23BrFNO2 and a molecular weight of 360.27 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)-(4-ethoxyoxan-4-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)-(4-ethoxyoxan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 116765825 |
| Molecular Formula | C16H23BrFNO2 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)-(4-ethoxyoxan-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Br)ccc1F)C1(OCC)CCOCC1 |
| InChI | InChI=1S/C16H23BrFNO2/c1-3-19-15(13-11-12(17)5-6-14(13)18)16(21-4-2)7-9-20-10-8-16/h5-6,11,15,19H,3-4,7-10H2,1-2H3 |
| InChIKey | RBTKVBIZWKMNLE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |