C15H21F2NO2 — CID 116765724
1-(3,4-difluorophenyl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine (PubChem CID 116765724) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116765724 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine |
| SMILES | CCOC1(C(NC)c2ccc(F)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C15H21F2NO2/c1-3-20-15(6-8-19-9-7-15)14(18-2)11-4-5-12(16)13(17)10-11/h4-5,10,14,18H,3,6-9H2,1-2H3 |
| InChIKey | YNLDYNXPEGVHJR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |