C18H28FNO — CID 116770881
1-(1-ethoxycycloheptyl)-1-(4-fluoro-3-methylphenyl)-N-methylmethanamine (PubChem CID 116770881) has the molecular formula C18H28FNO and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-(1-ethoxycycloheptyl)-1-(4-fluoro-3-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(1-ethoxycycloheptyl)-1-(4-fluoro-3-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116770881 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 1-(1-ethoxycycloheptyl)-1-(4-fluoro-3-methylphenyl)-N-methylmethanamine |
| SMILES | CCOC1(C(NC)c2ccc(F)c(C)c2)CCCCCC1 |
| InChI | InChI=1S/C18H28FNO/c1-4-21-18(11-7-5-6-8-12-18)17(20-3)15-9-10-16(19)14(2)13-15/h9-10,13,17,20H,4-8,11-12H2,1-3H3 |
| InChIKey | CPLYHKBYHRDHPJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |