C12H16FNO — CID 82283865
(1-aminocyclopentyl)-(2-fluorophenyl)methanol (PubChem CID 82283865) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (1-aminocyclopentyl)-(2-fluorophenyl)methanol.
| Compound Name | (1-aminocyclopentyl)-(2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 82283865 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (1-aminocyclopentyl)-(2-fluorophenyl)methanol |
| SMILES | NC1(C(O)c2ccccc2F)CCCC1 |
| InChI | InChI=1S/C12H16FNO/c13-10-6-2-1-5-9(10)11(15)12(14)7-3-4-8-12/h1-2,5-6,11,15H,3-4,7-8,14H2 |
| InChIKey | PYEXVNCBLONXOB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |