C13H19NO2 — CID 117316621
1-[2-(1-aminocyclopentyl)phenyl]ethane-1,2-diol (PubChem CID 117316621) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[2-(1-aminocyclopentyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[2-(1-aminocyclopentyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117316621 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[2-(1-aminocyclopentyl)phenyl]ethane-1,2-diol |
| SMILES | NC1(c2ccccc2C(O)CO)CCCC1 |
| InChI | InChI=1S/C13H19NO2/c14-13(7-3-4-8-13)11-6-2-1-5-10(11)12(16)9-15/h1-2,5-6,12,15-16H,3-4,7-9,14H2 |
| InChIKey | LOLHLNWVBDHHGT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |