C11H16N2O — CID 116944252
[1-[amino(pyridin-2-yl)methyl]cyclobutyl]methanol (PubChem CID 116944252) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is [1-[amino(pyridin-2-yl)methyl]cyclobutyl]methanol.
| Compound Name | [1-[amino(pyridin-2-yl)methyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 116944252 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | [1-[amino(pyridin-2-yl)methyl]cyclobutyl]methanol |
| SMILES | NC(c1ccccn1)C1(CO)CCC1 |
| InChI | InChI=1S/C11H16N2O/c12-10(9-4-1-2-7-13-9)11(8-14)5-3-6-11/h1-2,4,7,10,14H,3,5-6,8,12H2 |
| InChIKey | WAYQXNRJUWPJQG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |