C11H18N2 — CID 99737676
(1S)-3,3-dimethyl-1-pyridin-2-ylbutan-1-amine (PubChem CID 99737676) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1S)-3,3-dimethyl-1-pyridin-2-ylbutan-1-amine.
| Compound Name | (1S)-3,3-dimethyl-1-pyridin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 99737676 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1S)-3,3-dimethyl-1-pyridin-2-ylbutan-1-amine |
| SMILES | CC(C)(C)C[C@H](N)c1ccccn1 |
| InChI | InChI=1S/C11H18N2/c1-11(2,3)8-9(12)10-6-4-5-7-13-10/h4-7,9H,8,12H2,1-3H3/t9-/m0/s1 |
| InChIKey | MDTKLKWYQIPWQQ-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |