C12H20N2 — CID 99737673
(1S)-3,3-dimethyl-1-(6-methyl-2-pyridinyl)butan-1-amine (PubChem CID 99737673) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (1S)-3,3-dimethyl-1-(6-methyl-2-pyridinyl)butan-1-amine.
| Compound Name | (1S)-3,3-dimethyl-1-(6-methyl-2-pyridinyl)butan-1-amine |
|---|---|
| PubChem CID | 99737673 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (1S)-3,3-dimethyl-1-(6-methyl-2-pyridinyl)butan-1-amine |
| SMILES | Cc1cccc([C@@H](N)CC(C)(C)C)n1 |
| InChI | InChI=1S/C12H20N2/c1-9-6-5-7-11(14-9)10(13)8-12(2,3)4/h5-7,10H,8,13H2,1-4H3/t10-/m0/s1 |
| InChIKey | YMXFCRWJAKPYNE-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |