C11H13F2NO — CID 116943233
[1-[amino-(2,4-difluorophenyl)methyl]cyclopropyl]methanol (PubChem CID 116943233) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is [1-[amino-(2,4-difluorophenyl)methyl]cyclopropyl]methanol.
| Compound Name | [1-[amino-(2,4-difluorophenyl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 116943233 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [1-[amino-(2,4-difluorophenyl)methyl]cyclopropyl]methanol |
| SMILES | NC(c1ccc(F)cc1F)C1(CO)CC1 |
| InChI | InChI=1S/C11H13F2NO/c12-7-1-2-8(9(13)5-7)10(14)11(6-15)3-4-11/h1-2,5,10,15H,3-4,6,14H2 |
| InChIKey | QLRKOAFKLPWXGE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |