C13H19FN+ — CID 7439813
1-[(2-fluorophenyl)methyl]azepan-1-ium (PubChem CID 7439813) has the molecular formula C13H19FN+ and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]azepan-1-ium.
| Compound Name | 1-[(2-fluorophenyl)methyl]azepan-1-ium |
|---|---|
| PubChem CID | 7439813 |
| Molecular Formula | C13H19FN+ |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]azepan-1-ium |
| SMILES | Fc1ccccc1C[NH+]1CCCCCC1 |
| InChI | InChI=1S/C13H18FN/c14-13-8-4-3-7-12(13)11-15-9-5-1-2-6-10-15/h3-4,7-8H,1-2,5-6,9-11H2/p+1 |
| InChIKey | BWEXQNMZSQNIDU-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |