C20H26N3OS+ — CID 8562833
1-(4-methoxyphenyl)-3-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea (PubChem CID 8562833) has the molecular formula C20H26N3OS+ and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 8562833 |
| Molecular Formula | C20H26N3OS+ |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCc2ccccc2C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N3OS/c1-24-19-10-8-18(9-11-19)22-20(25)21-14-16-6-2-3-7-17(16)15-23-12-4-5-13-23/h2-3,6-11H,4-5,12-15H2,1H3,(H2,21,22,25)/p+1 |
| InChIKey | IJVXFNRXMFCZBT-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|