C21H24F3N3OS — CID 8500320
1-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]thiourea (PubChem CID 8500320) has the molecular formula C21H24F3N3OS and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 8500320 |
| Molecular Formula | C21H24F3N3OS |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)NCc2ccccc2CN2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24F3N3OS/c22-21(23,24)28-19-10-8-18(9-11-19)26-20(29)25-14-16-6-2-3-7-17(16)15-27-12-4-1-5-13-27/h2-3,6-11H,1,4-5,12-15H2,(H2,25,26,29) |
| InChIKey | BBEJQTJXEKDYJK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|