C19H21F3N4OS — CID 3333789
4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide (PubChem CID 3333789) has the molecular formula C19H21F3N4OS and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3333789 |
| Molecular Formula | C19H21F3N4OS |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)N2CCCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C19H21F3N4OS/c20-19(21,22)27-17-4-2-16(3-5-17)24-18(28)26-11-1-10-25(12-13-26)14-15-6-8-23-9-7-15/h2-9H,1,10-14H2,(H,24,28) |
| InChIKey | YMKXACLXPCHIEZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|