C18H20BrClN4S — CID 3809810
N-(4-bromo-2-chlorophenyl)-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carbothioamide (PubChem CID 3809810) has the molecular formula C18H20BrClN4S and a molecular weight of 439.81 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3809810 |
| Molecular Formula | C18H20BrClN4S |
| Molecular Weight | 439.81 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Br)cc1Cl)N1CCCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C18H20BrClN4S/c19-15-2-3-17(16(20)12-15)22-18(25)24-9-1-8-23(10-11-24)13-14-4-6-21-7-5-14/h2-7,12H,1,8-11,13H2,(H,22,25) |
| InChIKey | QZPUCGUMVXGXTE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|