C22H26BrClN4OS — CID 3834791
2-[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 3834791) has the molecular formula C22H26BrClN4OS and a molecular weight of 509.90 g/mol. Its IUPAC name is 2-[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3834791 |
| Molecular Formula | C22H26BrClN4OS |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1CCCN(C(=S)Nc2ccc(Br)cc2Cl)CC1)NCCc1ccccc1 |
| InChI | InChI=1S/C22H26BrClN4OS/c23-18-7-8-20(19(24)15-18)26-22(30)28-12-4-11-27(13-14-28)16-21(29)25-10-9-17-5-2-1-3-6-17/h1-3,5-8,15H,4,9-14,16H2,(H,25,29)(H,26,30) |
| InChIKey | PEXVWLHXAFRDES-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|