C24H36N4OS — CID 74225204
2-[4-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 74225204) has the molecular formula C24H36N4OS and a molecular weight of 428.65 g/mol. Its IUPAC name is 2-[4-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 74225204 |
| Molecular Formula | C24H36N4OS |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[4-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1CCCN(C(=S)NCCC2=CCCCC2)CC1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H36N4OS/c29-23(25-14-12-21-8-3-1-4-9-21)20-27-16-7-17-28(19-18-27)24(30)26-15-13-22-10-5-2-6-11-22/h1,3-4,8-10H,2,5-7,11-20H2,(H,25,29)(H,26,30) |
| InChIKey | VYQRCCMZTXIWHU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|