C21H24BrClN4OS — CID 23825392
N-[4-[[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]methyl]phenyl]acetamide (PubChem CID 23825392) has the molecular formula C21H24BrClN4OS and a molecular weight of 495.87 g/mol. Its IUPAC name is N-[4-[[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23825392 |
| Molecular Formula | C21H24BrClN4OS |
| Molecular Weight | 495.87 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N-[4-[[4-[(4-bromo-2-chlorophenyl)carbamothioyl]-1,4-diazepan-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCCN(C(=S)Nc3ccc(Br)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H24BrClN4OS/c1-15(28)24-18-6-3-16(4-7-18)14-26-9-2-10-27(12-11-26)21(29)25-20-8-5-17(22)13-19(20)23/h3-8,13H,2,9-12,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | HGHBPAHEGAGAOB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|