C15H20ClN3OS — CID 3550646
4-acetyl-N-(2-chloro-4-methylphenyl)-1,4-diazepane-1-carbothioamide (PubChem CID 3550646) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is 4-acetyl-N-(2-chloro-4-methylphenyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-acetyl-N-(2-chloro-4-methylphenyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3550646 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-acetyl-N-(2-chloro-4-methylphenyl)-1,4-diazepane-1-carbothioamide |
| SMILES | CC(=O)N1CCCN(C(=S)Nc2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20ClN3OS/c1-11-4-5-14(13(16)10-11)17-15(21)19-7-3-6-18(8-9-19)12(2)20/h4-5,10H,3,6-9H2,1-2H3,(H,17,21) |
| InChIKey | YIWKUQXMYARXQE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|