C18H21ClN4S — CID 3267098
N-(2-chloro-4-methylphenyl)-4-(6-methyl-2-pyridinyl)piperazine-1-carbothioamide (PubChem CID 3267098) has the molecular formula C18H21ClN4S and a molecular weight of 360.91 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-4-(6-methyl-2-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-4-(6-methyl-2-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3267098 |
| Molecular Formula | C18H21ClN4S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-4-(6-methyl-2-pyridinyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(c3cccc(C)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN4S/c1-13-6-7-16(15(19)12-13)21-18(24)23-10-8-22(9-11-23)17-5-3-4-14(2)20-17/h3-7,12H,8-11H2,1-2H3,(H,21,24) |
| InChIKey | MMNGWCDRFJMLNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|