C17H17BrClN3OS — CID 17374190
N-(4-bromo-2-chlorophenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide (PubChem CID 17374190) has the molecular formula C17H17BrClN3OS and a molecular weight of 426.77 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17374190 |
| Molecular Formula | C17H17BrClN3OS |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide |
| SMILES | Oc1ccc(N2CCN(C(=S)Nc3ccc(Br)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C17H17BrClN3OS/c18-12-1-6-16(15(19)11-12)20-17(24)22-9-7-21(8-10-22)13-2-4-14(23)5-3-13/h1-6,11,23H,7-10H2,(H,20,24) |
| InChIKey | WEJJXMSYQPODKM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|