C14H18BrClN2S — CID 19654017
N-(4-bromo-2-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide (PubChem CID 19654017) has the molecular formula C14H18BrClN2S and a molecular weight of 361.74 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 19654017 |
| Molecular Formula | C14H18BrClN2S |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2,6-dimethylpiperidine-1-carbothioamide |
| SMILES | CC1CCCC(C)N1C(=S)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H18BrClN2S/c1-9-4-3-5-10(2)18(9)14(19)17-13-7-6-11(15)8-12(13)16/h6-10H,3-5H2,1-2H3,(H,17,19) |
| InChIKey | YURLSIQZHNDWFL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|