C14H19Cl2N3S — CID 4139413
1-(2,4-dichlorophenyl)-3-(2,6-dimethylpiperidin-1-yl)thiourea (PubChem CID 4139413) has the molecular formula C14H19Cl2N3S and a molecular weight of 332.30 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2,6-dimethylpiperidin-1-yl)thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2,6-dimethylpiperidin-1-yl)thiourea |
|---|---|
| PubChem CID | 4139413 |
| Molecular Formula | C14H19Cl2N3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2,6-dimethylpiperidin-1-yl)thiourea |
| SMILES | CC1CCCC(C)N1NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3S/c1-9-4-3-5-10(2)19(9)18-14(20)17-13-7-6-11(15)8-12(13)16/h6-10H,3-5H2,1-2H3,(H2,17,18,20) |
| InChIKey | YKVKJYGGCONHPB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|