C14H19ClN2O — CID 43772607
1-[4-(2-chloro-4-methylanilino)piperidin-1-yl]ethanone (PubChem CID 43772607) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 1-[4-(2-chloro-4-methylanilino)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(2-chloro-4-methylanilino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 43772607 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[4-(2-chloro-4-methylanilino)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN2O/c1-10-3-4-14(13(15)9-10)16-12-5-7-17(8-6-12)11(2)18/h3-4,9,12,16H,5-8H2,1-2H3 |
| InChIKey | ROOLCAMXMGQAKU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |