C14H19ClIN3O — CID 83262468
4-(2-chloro-4-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 83262468) has the molecular formula C14H19ClIN3O and a molecular weight of 407.68 g/mol. Its IUPAC name is 4-(2-chloro-4-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-(2-chloro-4-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 83262468 |
| Molecular Formula | C14H19ClIN3O |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 4-(2-chloro-4-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(Nc2ccc(I)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClIN3O/c1-18(2)14(20)19-7-5-11(6-8-19)17-13-4-3-10(16)9-12(13)15/h3-4,9,11,17H,5-8H2,1-2H3 |
| InChIKey | IMTGHBXBCNKVCA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|